Chemical Name: 3-Glycidoxypropyltrimethoxy silane
Chemical Structure: CH2-CHCH2OCH2CH2CH2Si(OCH3)3
\ /
O
Molecular Formula: C9H20O5Si
Characteristic and Usage: Silane A-187 is a new type of bifunctional coupling agent with epoxy group and trimethoxysilyl group, can be easily hydrolyzed and crosslink. The dual nature allows K-56 bind chemically both inorganic materials (glass, sand, fillers) and organic polymers (thermosets, thermoplastics)
1. Glass fiber/glass fabric: as a finish or size ingredient
2. Foundry resin: as an additive to polyurethane resins
3. Mineral filled composites: for pretreatment of fillers and primer for improving adhesion to the polymer
4. Paints and coatings: as an additive and as a primer for improving adhesion to the substrate, especially glass and metal.
SPECIFICATION
Item | First-Grade | Top-Grade |
Appearance(APHA) | ≤30 | ≤10 |
GC Purity (%) | ≥95.0 | ≥98.0 |
Density(25℃) | 1.060-1.080 | |
Refractive index(25℃) | 1.420-1.430 |
Packing and Storage
1. Silane A-187 should be hermetically stored, because of its reactivity, it will be hydrolyzed by moisture to form polymer.
2. Silane A-187 is supplied in 10kg, 20kg, 200kg (net weight) internally new iron drum.
3. Silane A-187 can little stimulate skin and eyes, so labor protection is necessary when contacting.